You can:
Name | Butanedioic acid, compd. with 5-methoxy-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole (1:1) |
---|---|
Molecular formula | C18H22N2O5 |
IUPAC name | butanedioic acid;5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole |
Molecular weight | 346.383 |
Hydrogen bond acceptor | 6 |
Hydrogen bond donor | 4 |
XlogP | None |
Synonyms | UNII-RKG24J8KJR 5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indole succinate MLS000758988 RKG24J8KJR AC1Q5VR3 [ Show all ] |
Inchi Key | AFNQSRYIQUAMNM-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C14H16N2O.C4H6O4/c1-17-11-2-3-14-12(8-11)13(9-16-14)10-4-6-15-7-5-10;5-3(6)1-2-4(7)8/h2-4,8-9,15-16H,5-7H2,1H3;1-2H2,(H,5,6)(H,7,8) |
PubChem CID | 108028 |
ChEMBL | N/A |
IUPHAR | N/A |
BindingDB | N/A |
DrugBank | N/A |
Structure | ![]() |
Lipinski's druglikeness | Partition coefficient log P of this ligand is not available. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
4306 | 5-hydroxytryptamine receptor 1A | P08908 | HTR1A | Homo sapiens (Human) | 422 |
4304 | 5-hydroxytryptamine receptor 1B | O08892 | HTR1B | Cavia porcellus (Guinea pig) | 389 |
4308 | 5-hydroxytryptamine receptor 1B | P28222 | HTR1B | Homo sapiens (Human) | 390 |
4302 | 5-hydroxytryptamine receptor 1D | P28221 | HTR1D | Homo sapiens (Human) | 377 |
4303 | 5-hydroxytryptamine receptor 1D | P79400 | HTR1D | Sus scrofa (Pig) | 291 |
4305 | 5-hydroxytryptamine receptor 2A | P28223 | HTR2A | Homo sapiens (Human) | 471 |
4301 | 5-hydroxytryptamine receptor 2B | P41595 | HTR2B | Homo sapiens (Human) | 481 |
4309 | 5-hydroxytryptamine receptor 2C | P28335 | HTR2C | Homo sapiens (Human) | 458 |
4307 | 5-hydroxytryptamine receptor 6 | P50406 | HTR6 | Homo sapiens (Human) | 440 |
zhanglabzhanggroup.org | +65-6601-1241 | Computing 1, 13 Computing Drive, Singapore 117417