You can:
Name | CHEMBL52396 |
---|---|
Molecular formula | C25H30N2O4 |
IUPAC name | 2-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]butyl]isoindole-1,3-dione |
Molecular weight | 422.525 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 0 |
XlogP | 4.3 |
Synonyms | CHEMBL283207 2-{4-[(5-Methoxy-chroman-3-yl)-propyl-amino]-butyl}-isoindole-1,3-dione; compound with oxalic acid LS-84564 BDBM50036844 3-[N-PROPYL-N-(4-PHTHALIMIDOBUTYL)AMINO]-5-METHOXYCHROMAN [ Show all ] |
Inchi Key | ISIUTFCGQWDGHC-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C25H30N2O4/c1-3-13-26(18-16-21-22(30-2)11-8-12-23(21)31-17-18)14-6-7-15-27-24(28)19-9-4-5-10-20(19)25(27)29/h4-5,8-12,18H,3,6-7,13-17H2,1-2H3 |
PubChem CID | 10251673 |
ChEMBL | CHEMBL283207 |
IUPHAR | N/A |
BindingDB | 50036844 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
140729 | 5-hydroxytryptamine receptor 1A | P19327 | Htr1a | Rattus norvegicus (Rat) | 422 |
140734 | 5-hydroxytryptamine receptor 1A | P08908 | HTR1A | Homo sapiens (Human) | 422 |
140731 | 5-hydroxytryptamine receptor 1B | P28564 | Htr1b | Rattus norvegicus (Rat) | 386 |
140735 | 5-hydroxytryptamine receptor 1B | P28222 | HTR1B | Homo sapiens (Human) | 390 |
140732 | 5-hydroxytryptamine receptor 2A | Q75Z89 | HTR2A | Bos taurus (Bovine) | 470 |
140733 | Alpha-1A adrenergic receptor | P18130 | ADRA1A | Bos taurus (Bovine) | 466 |
140737 | Alpha-2A adrenergic receptor | Q28838 | ADRA2A | Bos taurus (Bovine) | 452 |
140736 | D(1A) dopamine receptor | Q95136 | DRD1 | Bos taurus (Bovine) | 446 |
140730 | D(2) dopamine receptor | P20288 | DRD2 | Bos taurus (Bovine) | 444 |
zhanglabzhanggroup.org | +65-6601-1241 | Computing 1, 13 Computing Drive, Singapore 117417