You can:
Name | Muscarinic acetylcholine receptor M4 |
---|---|
Species | Homo sapiens (Human) |
Gene | CHRM4 |
Synonym | HM3 M4 receptor cholinergic receptor Chrm-4 cholinergic receptor, muscarinic 4 |
Disease | Produce mydriasis and cycloplegia for diagnostic purposes Hypertension Irritable bowel syndrome Moderate and severe psychomotor agitation Mydriasis diagnosis [ Show all ] |
Length | 479 |
Amino acid sequence | MANFTPVNGSSGNQSVRLVTSSSHNRYETVEMVFIATVTGSLSLVTVVGNILVMLSIKVNRQLQTVNNYFLFSLACADLIIGAFSMNLYTVYIIKGYWPLGAVVCDLWLALDYVVSNASVMNLLIISFDRYFCVTKPLTYPARRTTKMAGLMIAAAWVLSFVLWAPAILFWQFVVGKRTVPDNQCFIQFLSNPAVTFGTAIAAFYLPVVIMTVLYIHISLASRSRVHKHRPEGPKEKKAKTLAFLKSPLMKQSVKKPPPGEAAREELRNGKLEEAPPPALPPPPRPVADKDTSNESSSGSATQNTKERPATELSTTEATTPAMPAPPLQPRALNPASRWSKIQIVTKQTGNECVTAIEIVPATPAGMRPAANVARKFASIARNQVRKKRQMAARERKVTRTIFAILLAFILTWTPYNVMVLVNTFCQSCIPDTVWSIGYWLCYVNSTINPACYALCNATFKKTFRHLLLCQYRNIGTAR |
UniProt | P08173 |
Protein Data Bank | 5dsg |
GPCR-HGmod model | P08173 |
3D structure model | This structure is from PDB ID 5dsg. |
BioLiP | BL0339919,BL0339921, BL0339920 |
Therapeutic Target Database | T20709, T50918 |
ChEMBL | CHEMBL1821 |
IUPHAR | 16 |
DrugBank | BE0000405 |
Name | Methoctramine |
---|---|
Molecular formula | C36H62N4O2 |
IUPAC name | N,N'-bis[6-[(2-methoxyphenyl)methylamino]hexyl]octane-1,8-diamine |
Molecular weight | 582.918 |
Hydrogen bond acceptor | 6 |
Hydrogen bond donor | 4 |
XlogP | 6.8 |
Synonyms | N,N'-bis[6-[(2-Methoxyphenyl)methylamino]hexyl]octane-1,8-diamine NCGC00162283-01 CCG-204944 Lopac-M-105 N1,N8-bis(6-(2-methoxybenzylamino)hexyl)octane-1,8-diamine [ Show all ] |
Inchi Key | RPMBYDYUVKEZJA-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C36H62N4O2/c1-41-35-23-13-11-21-33(35)31-39-29-19-9-7-17-27-37-25-15-5-3-4-6-16-26-38-28-18-8-10-20-30-40-32-34-22-12-14-24-36(34)42-2/h11-14,21-24,37-40H,3-10,15-20,25-32H2,1-2H3 |
PubChem CID | 4108 |
ChEMBL | CHEMBL27673 |
IUPHAR | 327 |
BindingDB | 50064176 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand is heavier than 500 daltons. This ligand has a partition coefficient log P greater than 5. |
Parameter | Value | Reference | Database source |
---|---|---|---|
Ki | 31.62 nM | PMID1994002 | BindingDB |
Ki | 31.6228 nM | PMID1994002, PMID8016895 | PDSP |
Ki | 31.6228 - 251.189 nM | PMID8759038, PMID2704370, PMID1994002, PMID9113359 | IUPHAR |
Ki | 37.97 nM | PMID7805774 | PDSP,BindingDB |
Ki | 38.0 nM | PMID11708906 | BindingDB,ChEMBL |
Ki | 66.06 nM | PMID9834968 | BindingDB |
Ki | 72.44 nM | PMID9834968 | BindingDB |
Ki | 107.15 nM | PMID17276075 | ChEMBL |
pKb | 6.45 - | PMID17276075 | ChEMBL |
zhanglabzhanggroup.org | +65-6601-1241 | Computing 1, 13 Computing Drive, Singapore 117417