Structure of PDB 4ugs Chain A Binding Site BS03 |
|
|
Ligand ID | H36 |
InChI | InChI=1S/C24H22N4O2S2/c25-23(21-9-3-13-31-21)27-17-5-1-7-19(15-17)29-11-12-30-20-8-2-6-18(16-20)28-24(26)22-10-4-14-32-22/h1-10,13-16H,11-12H2,(H2,25,27)(H2,26,28) |
InChIKey | FJVFGYSUSVNZDG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N=C(Nc1cccc(OCCOc2cccc(NC(=N)c3sccc3)c2)c1)c4sccc4 | ACDLabs 12.01 | s1cccc1C(=[N@H])Nc4cccc(OCCOc3cc(NC(=[N@H])c2sccc2)ccc3)c4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)OCCOc2cccc(c2)NC(=N)c3cccs3)NC(=N)c4cccs4 | OpenEye OEToolkits 1.7.6 | [H]/N=C(\Nc1cc(ccc1)OCCOc2cc(ccc2)N/C(=N/[H])/c3sccc3)/c4sccc4 |
|
Formula | C24 H22 N4 O2 S2 |
Name | N,N'-[ethane-1,2-diylbis(oxybenzene-3,1-diyl)]dithiophene-2-carboximidamide |
ChEMBL | CHEMBL3128243 |
DrugBank | |
ZINC | ZINC000098208982
|
PDB chain | 4ugs Chain A Residue 904
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|