Structure of PDB 4rkz Chain A Binding Site BS02 |
|
|
Ligand ID | 3S4 |
InChI | InChI=1S/C6H13O7P/c1-6(2-3-7,4-5(8)9)13-14(10,11)12/h7H,2-4H2,1H3,(H,8,9)(H2,10,11,12)/t6-/m1/s1 |
InChIKey | VWCNCYQNEAUWMQ-ZCFIWIBFSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(OC(CCO)(C)CC(=O)O)(O)O | OpenEye OEToolkits 1.7.6 | C[C@@](CCO)(CC(=O)O)OP(=O)(O)O | CACTVS 3.385 | C[C](CCO)(CC(O)=O)O[P](O)(O)=O | OpenEye OEToolkits 1.7.6 | CC(CCO)(CC(=O)O)OP(=O)(O)O | CACTVS 3.385 | C[C@@](CCO)(CC(O)=O)O[P](O)(O)=O |
|
Formula | C6 H13 O7 P |
Name | (3R)-5-hydroxy-3-methyl-3-(phosphonooxy)pentanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000114243420
|
PDB chain | 4rkz Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.185: mevalonate 3-kinase. |
|
|
|