Structure of PDB 4jyg Chain A Binding Site BS02 |
|
|
Ligand ID | 1NY |
InChI | InChI=1S/C26H23NO3/c1-26(2)15-14-21(17-6-4-3-5-7-17)22-16-19(10-13-23(22)26)24(28)27-20-11-8-18(9-12-20)25(29)30/h3-14,16H,15H2,1-2H3,(H,27,28)(H,29,30) |
InChIKey | AZQWAFBHDUNJHM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC1(C)CC=C(c2ccccc2)c3cc(ccc13)C(=O)Nc4ccc(cc4)C(O)=O | OpenEye OEToolkits 1.7.6 | CC1(CC=C(c2c1ccc(c2)C(=O)Nc3ccc(cc3)C(=O)O)c4ccccc4)C | ACDLabs 12.01 | O=C(O)c1ccc(cc1)NC(=O)c4ccc2c(C(=CCC2(C)C)c3ccccc3)c4 |
|
Formula | C26 H23 N O3 |
Name | 4-{[(5,5-dimethyl-8-phenyl-5,6-dihydronaphthalen-2-yl)carbonyl]amino}benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4jyg Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|