Structure of PDB 4gl5 Chain A Binding Site BS02 |
|
|
Ligand ID | G29 |
InChI | InChI=1S/C23H28O3/c1-4-5-12-26-20-14-16-17-6-7-21(25)23(17,3)11-9-18(16)22(2)10-8-15(24)13-19(20)22/h8,10,13,16-18,20H,6-7,9,11-12,14H2,1-3H3/t16-,17-,18-,20+,22+,23-/m0/s1 |
InChIKey | GNDYBZKXORBCFO-KVAKACLVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC#CCO[CH]1C[CH]2[CH]3CCC(=O)[C]3(C)CC[CH]2[C]4(C)C=CC(=O)C=C14 | OpenEye OEToolkits 1.7.6 | CC#CCO[C@@H]1C[C@H]2[C@@H]3CCC(=O)[C@]3(CC[C@@H]2[C@@]4(C1=CC(=O)C=C4)C)C | OpenEye OEToolkits 1.7.6 | CC#CCOC1CC2C3CCC(=O)C3(CCC2C4(C1=CC(=O)C=C4)C)C | ACDLabs 12.01 | O=C4C3(CCC2C1(C=CC(=O)C=C1C(OCC#CC)CC2C3CC4)C)C | CACTVS 3.370 | CC#CCO[C@@H]1C[C@H]2[C@@H]3CCC(=O)[C@@]3(C)CC[C@@H]2[C@@]4(C)C=CC(=O)C=C14 |
|
Formula | C23 H28 O3 |
Name | (6alpha,8alpha)-6-(but-2-yn-1-yloxy)androsta-1,4-diene-3,17-dione |
ChEMBL | CHEMBL2179109 |
DrugBank | |
ZINC | ZINC000095576292
|
PDB chain | 4gl5 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|