Structure of PDB 3ptg Chain A Binding Site BS02 |
|
|
Ligand ID | 932 |
InChI | InChI=1S/C18H17N5O2S/c1-11-9-26-18(16(11)17-19-10-20-22-17)21-14(24)8-23-13-5-3-2-4-12(13)6-7-15(23)25/h2-5,9-10H,6-8H2,1H3,(H,21,24)(H,19,20,22) |
InChIKey | HJUDFJRTVGXBRF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1csc(c1c2[nH]ncn2)NC(=O)CN3c4ccccc4CCC3=O | ACDLabs 12.01 | O=C2N(c1ccccc1CC2)CC(=O)Nc4scc(c4c3ncnn3)C | CACTVS 3.370 | Cc1csc(NC(=O)CN2C(=O)CCc3ccccc23)c1c4[nH]ncn4 |
|
Formula | C18 H17 N5 O2 S |
Name | N-[4-methyl-3-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(2-oxo-3,4-dihydroquinolin-1(2H)-yl)acetamide |
ChEMBL | CHEMBL1614820 |
DrugBank | |
ZINC | ZINC000064750476
|
PDB chain | 3ptg Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|