Structure of PDB 1cin Chain A Binding Site BS02 |
|
|
Ligand ID | MTS |
InChI | InChI=1S/C9H14N2O4S3/c1-5-3-7(11-2)6-4-8(18(10,14)15)16-9(6)17(5,12)13/h4-5,7,11H,3H2,1-2H3,(H2,10,14,15)/t5-,7-/m0/s1 |
InChIKey | PYXFWOIZPYXNRU-FSPLSTOPSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=S(=O)(c1sc2c(c1)C(NC)CC(C)S2(=O)=O)N | CACTVS 3.341 | CN[CH]1C[CH](C)[S](=O)(=O)c2sc(cc12)[S](N)(=O)=O | CACTVS 3.341 | CN[C@H]1C[C@H](C)[S](=O)(=O)c2sc(cc12)[S](N)(=O)=O | OpenEye OEToolkits 1.5.0 | C[C@H]1C[C@@H](c2cc(sc2S1(=O)=O)S(=O)(=O)N)NC | OpenEye OEToolkits 1.5.0 | CC1CC(c2cc(sc2S1(=O)=O)S(=O)(=O)N)NC |
|
Formula | C9 H14 N2 O4 S3 |
Name | (4S-TRANS)-4-(METHYLAMINO)-5,6-DIHYDRO-6-METHYL-4H-THIENO(2,3-B)THIOPYRAN-2-SULFONAMIDE-7,7-DIOXIDE |
ChEMBL | CHEMBL273822 |
DrugBank | DB04081 |
ZINC | ZINC000003870400
|
PDB chain | 1cin Chain A Residue 264
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|