Structure of PDB 8zsp Chain R Binding Site BS01 |
|
|
Ligand ID | 7LD |
InChI | InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
InChIKey | VAYOSLLFUXYJDT-RDTXWAMCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCN(CC)C(=O)C1CN(C2Cc3c[nH]c4c3c(ccc4)C2=C1)C | CACTVS 3.385 | CCN(CC)C(=O)[CH]1CN(C)[CH]2Cc3c[nH]c4cccc(C2=C1)c34 | ACDLabs 12.01 | n1c4cccc2c4c(c1)CC3N(CC(C=C23)C(N(CC)CC)=O)C | OpenEye OEToolkits 2.0.6 | CCN(CC)C(=O)[C@H]1CN([C@@H]2Cc3c[nH]c4c3c(ccc4)C2=C1)C | CACTVS 3.385 | CCN(CC)C(=O)[C@H]1CN(C)[C@@H]2Cc3c[nH]c4cccc(C2=C1)c34 |
|
Formula | C20 H25 N3 O |
Name | (8alpha)-N,N-diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide; Lysergic acid diethylamide |
ChEMBL | CHEMBL263881 |
DrugBank | DB04829 |
ZINC | ZINC000096903803
|
PDB chain | 8zsp Chain R Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
Biological Process |
GO:0007186 |
G protein-coupled receptor signaling pathway |
GO:0007189 |
adenylate cyclase-activating G protein-coupled receptor signaling pathway |
GO:0007193 |
adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway |
GO:0007200 |
phospholipase C-activating G protein-coupled receptor signaling pathway |
|
|