Structure of PDB 8thk Chain R Binding Site BS01 |
|
|
Ligand ID | CGZ |
InChI | InChI=1S/C14H19N3O3S/c1-21(19,20)17-13-10-3-2-4-11(14-15-7-8-16-14)9(10)5-6-12(13)18/h5-6,11,17-18H,2-4,7-8H2,1H3,(H,15,16)/t11-/m0/s1 |
InChIKey | OQFCXJDXHCDLHX-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CS(=O)(=O)Nc1c(ccc2c1CCCC2C3=NCCN3)O | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)Nc1c(ccc2c1CCC[C@@H]2C3=NCCN3)O | CACTVS 3.385 | C[S](=O)(=O)Nc1c(O)ccc2[CH](CCCc12)C3=NCCN3 | ACDLabs 12.01 | CS(=O)(=O)Nc1c(O)ccc2C(CCCc21)C1=NCCN1 | CACTVS 3.385 | C[S](=O)(=O)Nc1c(O)ccc2[C@H](CCCc12)C3=NCCN3 |
|
Formula | C14 H19 N3 O3 S |
Name | N-[(5S)-5-(4,5-dihydro-1H-imidazol-2-yl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]methanesulfonamide |
ChEMBL | CHEMBL133451 |
DrugBank | |
ZINC | ZINC000003995494
|
PDB chain | 8thk Chain R Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|