Structure of PDB 7g00 Chain P Binding Site BS01 |
|
|
Ligand ID | WII |
InChI | InChI=1S/C21H25N3O4S/c1-21(2,3)20-22-16(24-28-20)15-13-7-4-5-10-14(13)29-18(15)23-17(25)11-8-6-9-12(11)19(26)27/h4-10H2,1-3H3,(H,23,25)(H,26,27) |
InChIKey | ZXVOGITXGGTCJD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(C)c1onc(n1)c2c3CCCCc3sc2NC(=O)C4=C(CCC4)C(O)=O | OpenEye OEToolkits 2.0.7 | CC(C)(C)c1nc(no1)c2c3c(sc2NC(=O)C4=C(CCC4)C(=O)O)CCCC3 | ACDLabs 12.01 | O=C(O)C=1CCCC=1C(=O)Nc1sc2CCCCc2c1c1nc(on1)C(C)(C)C |
|
Formula | C21 H25 N3 O4 S |
Name | 2-{[(3P)-3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl}cyclopent-1-ene-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7g00 Chain P Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|