Structure of PDB 4tqp Chain B Binding Site BS01 |
|
|
Ligand ID | 48R |
InChI | InChI=1S/C18H18N2O4S/c1-12(18(21)20-25(2,22)23)11-24-19-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12H,11H2,1-2H3,(H,20,21)/t12-/m1/s1 |
InChIKey | FRTXAYQPEDIBAD-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(CON=C1c2ccccc2-c3c1cccc3)C(=O)NS(=O)(=O)C | OpenEye OEToolkits 1.9.2 | C[C@H](CON=C1c2ccccc2-c3c1cccc3)C(=O)NS(=O)(=O)C | CACTVS 3.385 | C[CH](CON=C1c2ccccc2c3ccccc13)C(=O)N[S](C)(=O)=O | ACDLabs 12.01 | O=S(=O)(NC(=O)C(C)CO\N=C3/c1ccccc1c2c3cccc2)C | CACTVS 3.385 | C[C@H](CON=C1c2ccccc2c3ccccc13)C(=O)N[S](C)(=O)=O |
|
Formula | C18 H18 N2 O4 S |
Name | (2R)-3-[(9H-fluoren-9-ylideneamino)oxy]-2-methyl-N-(methylsulfonyl)propanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620436
|
PDB chain | 4tqp Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|