Structure of PDB 4k1l Chain B Binding Site BS01 |
|
|
Ligand ID | SFF |
InChI | InChI=1S/C13H22N2O3S/c16-19(17)12-9-5-4-8-11(12)18-13(15-19)14-10-6-2-1-3-7-10/h10-12H,1-9H2,(H,14,15)/t11-,12+/m0/s1 |
InChIKey | ZMDVQNCMHSXAPA-NWDGAFQWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S2(=O)N=C(OC1C2CCCC1)NC3CCCCC3 | OpenEye OEToolkits 1.7.6 | C1CCC(CC1)NC2=NS(=O)(=O)C3CCCCC3O2 | CACTVS 3.370 | O=[S]1(=O)N=C(NC2CCCCC2)O[C@H]3CCCC[C@@H]13 | OpenEye OEToolkits 1.7.6 | C1CCC(CC1)NC2=NS(=O)(=O)[C@@H]3CCCC[C@@H]3O2 | CACTVS 3.370 | O=[S]1(=O)N=C(NC2CCCCC2)O[CH]3CCCC[CH]13 |
|
Formula | C13 H22 N2 O3 S |
Name | (4aS,8aR)-N-cyclohexyl-4a,5,6,7,8,8a-hexahydro-4,1,2-benzoxathiazin-3-amine 1,1-dioxide |
ChEMBL | CHEMBL2409730 |
DrugBank | |
ZINC | ZINC000096273925
|
PDB chain | 4k1l Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S170 Y183 K187 |
Catalytic site (residue number reindexed from 1) |
S151 Y164 K168 |
Enzyme Commision number |
1.1.1.146: 11beta-hydroxysteroid dehydrogenase. 1.1.1.201: 7beta-hydroxysteroid dehydrogenase (NADP(+)). |
|
|
|