Structure of PDB 4cbt Chain B Binding Site BS01 |
|
|
Ligand ID | 9F4 |
InChI | InChI=1S/C20H16FN3O2/c21-15-10-22-19(23-11-15)14-8-6-13(7-9-14)17-16(18(17)20(25)24-26)12-4-2-1-3-5-12/h1-11,16-18,26H,(H,24,25)/t16-,17-,18-/m1/s1 |
InChIKey | QHCRWOYXPXJUJS-KZNAEPCWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | ONC(=O)[CH]1[CH]([CH]1c2ccc(cc2)c3ncc(F)cn3)c4ccccc4 | ACDLabs 12.01 | O=C(NO)C4C(c1ccccc1)C4c3ccc(c2ncc(F)cn2)cc3 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)C2C(C2C(=O)NO)c3ccc(cc3)c4ncc(cn4)F | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)[C@@H]2[C@H]([C@@H]2C(=O)NO)c3ccc(cc3)c4ncc(cn4)F | CACTVS 3.385 | ONC(=O)[C@@H]1[C@@H]([C@H]1c2ccc(cc2)c3ncc(F)cn3)c4ccccc4 |
|
Formula | C20 H16 F N3 O2 |
Name | (1R,2R,3R)-2-[4-(5-fluoranylpyrimidin-2-yl)phenyl]-N-oxidanyl-3-phenyl-cyclopropane-1-carboxamide |
ChEMBL | CHEMBL3110015 |
DrugBank | |
ZINC | ZINC000095920826
|
PDB chain | 4cbt Chain B Residue 2034
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.5.1.98: histone deacetylase. |
|
|