Structure of PDB 2ejg Chain B Binding Site BS01 |
|
|
Ligand ID | BTN |
InChI | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1 |
InChIKey | YBJHBAHKTGYVGT-ZKWXMUAHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CCCC[CH]1SC[CH]2NC(=O)N[CH]12 | CACTVS 3.385 | OC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@H]12 | ACDLabs 12.01 | O=C1NC2C(SCC2N1)CCCCC(=O)O | OpenEye OEToolkits 1.7.6 | C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 | OpenEye OEToolkits 1.7.6 | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2 |
|
Formula | C10 H16 N2 O3 S |
Name | BIOTIN |
ChEMBL | CHEMBL857 |
DrugBank | DB00121 |
ZINC | ZINC000035024346
|
PDB chain | 2ejg Chain B Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
A48 K111 |
Catalytic site (residue number reindexed from 1) |
A48 K111 |
Enzyme Commision number |
? |
|
|
|