Structure of PDB 6oi9 Chain A Binding Site BS01 |
|
|
Ligand ID | MQM |
InChI | InChI=1S/C18H18Cl2N6/c19-13-2-1-3-14(20)15(13)12-6-11-8-23-18(22)25-16(11)24-17(12)26-5-4-10(7-21)9-26/h1-3,6,8,10H,4-5,7,9,21H2,(H2,22,23,24,25)/t10-/m0/s1 |
InChIKey | ANABJNVAYVFJHB-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC[C@@H]1CCN(C1)c2nc3nc(N)ncc3cc2c4c(Cl)cccc4Cl | ACDLabs 12.01 | c42c(cc(c1c(Cl)cccc1Cl)c(n2)N3CC(CC3)CN)cnc(n4)N | CACTVS 3.385 | NC[CH]1CCN(C1)c2nc3nc(N)ncc3cc2c4c(Cl)cccc4Cl | OpenEye OEToolkits 2.0.7 | c1cc(c(c(c1)Cl)c2cc3cnc(nc3nc2N4CCC(C4)CN)N)Cl | OpenEye OEToolkits 2.0.7 | c1cc(c(c(c1)Cl)c2cc3cnc(nc3nc2N4CC[C@H](C4)CN)N)Cl |
|
Formula | C18 H18 Cl2 N6 |
Name | 7-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-6-(2,6-dichlorophenyl)pyrido[2,3-d]pyrimidin-2-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6oi9 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|