Structure of PDB 5cx9 Chain A Binding Site BS01 |
|
|
Ligand ID | 551 |
InChI | InChI=1S/C20H23ClN2O3/c1-26-20(25)13-19(24)23-11-5-10-22-14-15-8-9-17(18(21)12-15)16-6-3-2-4-7-16/h2-4,6-9,12,22H,5,10-11,13-14H2,1H3,(H,23,24) |
InChIKey | MTDVIYKGVPWNHL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)CC(=O)NCCCNCc1ccc(c(Cl)c1)c2ccccc2 | OpenEye OEToolkits 1.9.2 | COC(=O)CC(=O)NCCCNCc1ccc(c(c1)Cl)c2ccccc2 | ACDLabs 12.01 | C(=O)(CC(=O)NCCCNCc1cc(c(cc1)c2ccccc2)Cl)OC |
|
Formula | C20 H23 Cl N2 O3 |
Name | methyl 3-[(3-{[(2-chlorobiphenyl-4-yl)methyl]amino}propyl)amino]-3-oxopropanoate |
ChEMBL | CHEMBL4117028 |
DrugBank | |
ZINC | ZINC000584905140
|
PDB chain | 5cx9 Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|