Structure of PDB 4tyo Chain A Binding Site BS01 |
|
|
Ligand ID | 39X |
InChI | InChI=1S/C21H16FN3O3/c22-15-7-8-16-17(10-15)24-19(23-16)11-18(21(27)28)25-20(26)14-6-5-12-3-1-2-4-13(12)9-14/h1-10,18H,11H2,(H,23,24)(H,25,26)(H,27,28)/t18-/m1/s1 |
InChIKey | NKMPZFCFXCJBEY-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)[CH](Cc1[nH]c2cc(F)ccc2n1)NC(=O)c3ccc4ccccc4c3 | OpenEye OEToolkits 1.9.2 | c1ccc2cc(ccc2c1)C(=O)NC(Cc3[nH]c4cc(ccc4n3)F)C(=O)O | ACDLabs 12.01 | O=C(O)C(NC(=O)c2cc1ccccc1cc2)Cc4nc3ccc(F)cc3n4 | OpenEye OEToolkits 1.9.2 | c1ccc2cc(ccc2c1)C(=O)N[C@H](Cc3[nH]c4cc(ccc4n3)F)C(=O)O | CACTVS 3.385 | OC(=O)[C@@H](Cc1[nH]c2cc(F)ccc2n1)NC(=O)c3ccc4ccccc4c3 |
|
Formula | C21 H16 F N3 O3 |
Name | 3-(6-fluoro-1H-benzimidazol-2-yl)-N-(naphthalen-2-ylcarbonyl)-D-alanine |
ChEMBL | CHEMBL3322219 |
DrugBank | |
ZINC | ZINC000038224839
|
PDB chain | 4tyo Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|