Structure of PDB 4l3l Chain A Binding Site BS01 |
|
|
Ligand ID | 5FI |
InChI | InChI=1S/C19H21F3N6/c1-2-13-10-23-12-24-18(13)28-7-5-27(6-8-28)11-17-25-15-4-3-14(19(20,21)22)9-16(15)26-17/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,26) |
InChIKey | FBLPQCAQRNSVHB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC(F)(F)c1cc2nc(nc2cc1)CN4CCN(c3ncncc3CC)CC4 | CACTVS 3.370 OpenEye OEToolkits 1.7.6 | CCc1cncnc1N2CCN(CC2)Cc3[nH]c4ccc(cc4n3)C(F)(F)F |
|
Formula | C19 H21 F3 N6 |
Name | 2-{[4-(5-ethylpyrimidin-4-yl)piperazin-1-yl]methyl}-5-(trifluoromethyl)-1H-benzimidazole |
ChEMBL | CHEMBL2134202 |
DrugBank | |
ZINC | ZINC000071773472
|
PDB chain | 4l3l Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|