Structure of PDB 4gd6 Chain A Binding Site BS01 |
|
|
Ligand ID | 17K |
InChI | InChI=1S/C22H22N2O7S/c1-22(32(29)30,14-31-18(26)11-15-7-3-2-4-8-15)19(21(27)28)23-20-16(13-25)12-17-9-5-6-10-24(17)20/h2-10,12-13,19,23H,11,14H2,1H3,(H,27,28)(H,29,30)/t19-,22-/m0/s1 |
InChIKey | WQTYZCOJEVFYJF-UGKGYDQZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@](COC(=O)Cc1ccccc1)([C@H](C(=O)O)Nc2c(cc3n2cccc3)C=O)S(=O)O | ACDLabs 12.01 | O=C(O)C(Nc2c(cc1ccccn12)C=O)C(S(=O)O)(C)COC(=O)Cc3ccccc3 | CACTVS 3.370 | C[C](COC(=O)Cc1ccccc1)([CH](Nc2n3ccccc3cc2C=O)C(O)=O)[S](O)=O | OpenEye OEToolkits 1.7.6 | CC(COC(=O)Cc1ccccc1)(C(C(=O)O)Nc2c(cc3n2cccc3)C=O)S(=O)O | CACTVS 3.370 | C[C@](COC(=O)Cc1ccccc1)([C@@H](Nc2n3ccccc3cc2C=O)C(O)=O)[S](O)=O |
|
Formula | C22 H22 N2 O7 S |
Name | (3R)-N-(2-formylindolizin-3-yl)-4-[(phenylacetyl)oxy]-3-sulfino-D-valine; penam sulfone SA1-204, open form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920553
|
PDB chain | 4gd6 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|