Structure of PDB 4fsz Chain A Binding Site BS01 |
|
|
Ligand ID | HK8 |
InChI | InChI=1S/C15H11ClN2O3/c16-9-2-3-10-12(7-9)17-11-4-1-8(6-14(19)20)5-13(11)18-15(10)21/h1-5,7,17H,6H2,(H,18,21)(H,19,20) |
InChIKey | MFBFXFHWNXYFCJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc2c(cc1CC(=O)O)NC(=O)c3ccc(cc3N2)Cl | ACDLabs 12.01 | O=C(O)Cc3cc1c(Nc2c(C(=O)N1)ccc(Cl)c2)cc3 | CACTVS 3.370 | OC(=O)Cc1ccc2Nc3cc(Cl)ccc3C(=O)Nc2c1 |
|
Formula | C15 H11 Cl N2 O3 |
Name | (3-chloro-11-oxo-10,11-dihydro-5H-dibenzo[b,e][1,4]diazepin-8-yl)acetic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000071788611
|
PDB chain | 4fsz Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|