Structure of PDB 4cva Chain A Binding Site BS01 |
|
|
Ligand ID | WBI |
InChI | InChI=1S/C22H22N4O2/c27-21(17-4-6-19(7-5-17)26-12-2-1-3-13-26)25-20-14-18(15-24-22(20)28)16-8-10-23-11-9-16/h4-11,14-15H,1-3,12-13H2,(H,24,28)(H,25,27) |
InChIKey | ABBVAIMDGQMDHS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1NC=C(C=C1NC(=O)c2ccc(cc2)N3CCCCC3)c4ccncc4 | ACDLabs 12.01 | O=C2NC=C(c1ccncc1)C=C2NC(=O)c3ccc(cc3)N4CCCCC4 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)NC2=CC(=CNC2=O)c3ccncc3)N4CCCCC4 |
|
Formula | C22 H22 N4 O2 |
Name | N-(6-oxo-1,6-dihydro-3,4'-bipyridin-5-yl)-4-(piperidin-1-yl)benzamide |
ChEMBL | CHEMBL1765097 |
DrugBank | |
ZINC | ZINC000071316565
|
PDB chain | 4cva Chain A Residue 1795
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|