Structure of PDB 3qp0 Chain A Binding Site BS01 |
|
|
Ligand ID | NI8 |
InChI | InChI=1S/C22H25N3O4/c26-13-17-5-1-3-15(7-17)11-24-19-9-23-10-20(19)25(22(29)21(24)28)12-16-4-2-6-18(8-16)14-27/h1-8,19-20,23,26-27H,9-14H2/t19-,20-/m0/s1 |
InChIKey | BNGHHYKOKSEZPO-PMACEKPBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)CO)CN2C3CNCC3N(C(=O)C2=O)Cc4cccc(c4)CO | OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)CO)CN2[C@H]3CNC[C@@H]3N(C(=O)C2=O)Cc4cccc(c4)CO | CACTVS 3.370 | OCc1cccc(CN2[C@H]3CNC[C@@H]3N(Cc4cccc(CO)c4)C(=O)C2=O)c1 | CACTVS 3.370 | OCc1cccc(CN2[CH]3CNC[CH]3N(Cc4cccc(CO)c4)C(=O)C2=O)c1 | ACDLabs 12.01 | O=C1C(=O)N(C3CNCC3N1Cc2cccc(c2)CO)Cc4cccc(c4)CO |
|
Formula | C22 H25 N3 O4 |
Name | (4aS,7aS)-1,4-bis[3-(hydroxymethyl)benzyl]hexahydro-1H-pyrrolo[3,4-b]pyrazine-2,3-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209227
|
PDB chain | 3qp0 Chain B Residue 102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|