You can:
Name | CHEMBL48925 |
---|---|
Molecular formula | C25H34N2O4 |
IUPAC name | 2-methoxy-N-[4-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]butyl]benzamide |
Molecular weight | 426.557 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 1 |
XlogP | 4.6 |
Synonyms | 2-Methoxy-N-{4-[(5-methoxy-chroman-3-yl)-propyl-amino]-butyl}-benzamide; compound with oxalic acid CHEMBL28312 BDBM50036857 |
Inchi Key | CZSCSNOFEQMOLJ-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C25H34N2O4/c1-4-15-27(19-17-21-23(30-3)12-9-13-24(21)31-18-19)16-8-7-14-26-25(28)20-10-5-6-11-22(20)29-2/h5-6,9-13,19H,4,7-8,14-18H2,1-3H3,(H,26,28) |
PubChem CID | 10342423 |
ChEMBL | CHEMBL28312 |
IUPHAR | N/A |
BindingDB | 50036857 |
DrugBank | N/A |
Structure | ![]() |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
54609 | 5-hydroxytryptamine receptor 1A | P19327 | Htr1a | Rattus norvegicus (Rat) | 422 |
54613 | 5-hydroxytryptamine receptor 1B | P28564 | Htr1b | Rattus norvegicus (Rat) | 386 |
54611 | 5-hydroxytryptamine receptor 2A | Q75Z89 | HTR2A | Bos taurus (Bovine) | 470 |
54610 | Alpha-1A adrenergic receptor | P18130 | ADRA1A | Bos taurus (Bovine) | 466 |
54608 | Alpha-2A adrenergic receptor | Q28838 | ADRA2A | Bos taurus (Bovine) | 452 |
54612 | D(2) dopamine receptor | P20288 | DRD2 | Bos taurus (Bovine) | 444 |
zhanglabzhanggroup.org | +65-6601-1241 | Computing 1, 13 Computing Drive, Singapore 117417