Structure of PDB 5zo7 Chain A Binding Site BS02 |
|
|
Ligand ID | 5C5 |
InChI | InChI=1S/C25H25NO3S/c1-29-20-14-12-19(13-15-20)25(30-16-23(26)24(27)28)21-8-4-2-6-17(21)10-11-18-7-3-5-9-22(18)25/h2-9,12-15,23H,10-11,16,26H2,1H3,(H,27,28)/t23-/m0/s1 |
InChIKey | FFZDQAVDHIXOIW-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1ccc(cc1)C2(c3ccccc3CCc4c2cccc4)SCC(C(=O)O)N | CACTVS 3.385 | COc1ccc(cc1)[C]2(SC[CH](N)C(O)=O)c3ccccc3CCc4ccccc24 | OpenEye OEToolkits 2.0.6 | COc1ccc(cc1)C2(c3ccccc3CCc4c2cccc4)SC[C@@H](C(=O)O)N | CACTVS 3.385 | COc1ccc(cc1)[C@]2(SC[C@H](N)C(O)=O)c3ccccc3CCc4ccccc24 |
|
Formula | C25 H25 N O3 S |
Name | (2R)-2-azanyl-3-[[2-(4-methoxyphenyl)-2-tricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3,5,7,12,14-hexaenyl]sulfanyl]propanoic acid |
ChEMBL | CHEMBL3633366 |
DrugBank | |
ZINC | ZINC000205127264
|
PDB chain | 5zo7 Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|