Structure of PDB 3u7n Chain A Binding Site BS02 |
|
|
Ligand ID | UHF |
InChI | InChI=1S/C19H30N4O4/c1-5-6-7-15(11-23(27)12-24)18(25)17(13(2)3)22-19(26)21-16-9-8-14(4)10-20-16/h8-10,12-13,15,17,27H,5-7,11H2,1-4H3,(H2,20,21,22,26)/t15-,17+/m1/s1 |
InChIKey | AMPUUHFRILVRDV-WBVHZDCISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CCCCC(CN(C=O)O)C(=O)C(C(C)C)NC(=O)Nc1ccc(cn1)C | ACDLabs 12.01 | O=C(Nc1ncc(cc1)C)NC(C(=O)C(CCCC)CN(O)C=O)C(C)C | CACTVS 3.370 | CCCC[CH](CN(O)C=O)C(=O)[CH](NC(=O)Nc1ccc(C)cn1)C(C)C | OpenEye OEToolkits 1.7.2 | CCCC[C@H](CN(C=O)O)C(=O)[C@H](C(C)C)NC(=O)Nc1ccc(cn1)C | CACTVS 3.370 | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)Nc1ccc(C)cn1)C(C)C |
|
Formula | C19 H30 N4 O4 |
Name | N-((2R,4S)-2-butyl-5-methyl-4-(3-(5-methylpyridin-2-yl)ureido)-3-oxohexyl)-N-hydroxyformamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034886883
|
PDB chain | 3u7n Chain A Residue 192
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|