Structure of PDB 3s8x Chain A Binding Site BS02 |
|
|
Ligand ID | E59 |
InChI | InChI=1S/C13H13N3O4S2/c1-8-6-12(18)16-13(15-8)21-7-11(17)9-2-4-10(5-3-9)22(14,19)20/h2-6H,7H2,1H3,(H2,14,19,20)(H,15,16,18) |
InChIKey | UZGWPPSMIYIVBV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC1=CC(=O)NC(=N1)SCC(=O)c2ccc(cc2)[S](N)(=O)=O | OpenEye OEToolkits 1.7.2 | CC1=CC(=O)NC(=N1)SCC(=O)c2ccc(cc2)S(=O)(=O)N | ACDLabs 12.01 | O=C2C=C(N=C(SCC(=O)c1ccc(cc1)S(=O)(=O)N)N2)C |
|
Formula | C13 H13 N3 O4 S2 |
Name | 4-{[(4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl)sulfanyl]acetyl}benzenesulfonamide |
ChEMBL | CHEMBL2010988 |
DrugBank | |
ZINC | ZINC000084614731
|
PDB chain | 3s8x Chain A Residue 266
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|