Structure of PDB 2gnl Chain A Binding Site BS02 |
|
|
Ligand ID | H52 |
InChI | InChI=1S/C16H21N3O2S/c1-12-9-18-11-14-5-3-6-15(16(12)14)22(20,21)19-8-4-7-17-10-13(19)2/h3,5-6,9,11,13,17H,4,7-8,10H2,1-2H3/t13-/m0/s1 |
InChIKey | AWDORCFLUJZUQS-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1cncc2c1c(ccc2)S(=O)(=O)N3CCCNCC3C | OpenEye OEToolkits 1.5.0 | Cc1cncc2c1c(ccc2)S(=O)(=O)[N@]3CCCNC[C@@H]3C | CACTVS 3.341 | C[CH]1CNCCCN1[S](=O)(=O)c2cccc3cncc(C)c23 | CACTVS 3.341 | C[C@H]1CNCCCN1[S](=O)(=O)c2cccc3cncc(C)c23 | ACDLabs 10.04 | O=S(=O)(c2c1c(cncc1ccc2)C)N3C(CNCCC3)C |
|
Formula | C16 H21 N3 O2 S |
Name | (S)-2-METHYL-1-[(4-METHYL-5-ISOQUINOLINE)SULFONYL]-HOMOPIPERAZINE |
ChEMBL | CHEMBL406821 |
DrugBank | DB07876 |
ZINC | ZINC000000022706
|
PDB chain | 2gnl Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|