Structure of PDB 7kk3 Chain D Binding Site BS01 |
|
|
Ligand ID | 2YQ |
InChI | InChI=1S/C19H14F2N6O/c1-27-18(22-8-23-27)15-16(9-2-4-10(20)5-3-9)24-13-7-11(21)6-12-14(13)17(15)25-26-19(12)28/h2-8,15-16,24H,1H3,(H,26,28)/t15-,16-/m1/s1 |
InChIKey | HWGQMRYQVZSGDQ-HZPDHXFCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1ccc(cc1)C5Nc2c3c(cc(F)c2)C(=O)NN=C3C5c4ncnn4C | OpenEye OEToolkits 1.9.2 | Cn1c(ncn1)[C@@H]2[C@H](Nc3cc(cc4c3C2=NNC4=O)F)c5ccc(cc5)F | CACTVS 3.385 | Cn1ncnc1[CH]2[CH](Nc3cc(F)cc4C(=O)NN=C2c34)c5ccc(F)cc5 | CACTVS 3.385 | Cn1ncnc1[C@@H]2[C@H](Nc3cc(F)cc4C(=O)NN=C2c34)c5ccc(F)cc5 | OpenEye OEToolkits 1.9.2 | Cn1c(ncn1)C2C(Nc3cc(cc4c3C2=NNC4=O)F)c5ccc(cc5)F |
|
Formula | C19 H14 F2 N6 O |
Name | (8S,9R)-5-fluoro-8-(4-fluorophenyl)-9-(1-methyl-1H-1,2,4-triazol-5-yl)-2,7,8,9-tetrahydro-3H-pyrido[4,3,2-de]phthalazin-3-one; Talazoparib |
ChEMBL | CHEMBL3137320 |
DrugBank | DB11760 |
ZINC | ZINC000072318110
|
PDB chain | 7kk3 Chain D Residue 9001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|