Structure of PDB 4dko Chain C Binding Site BS01 |
|
|
Ligand ID | 0LM |
InChI | InChI=1S/C18H25ClFN3O2/c1-17(2)9-12(10-18(3,4)23(17)5)22-16(25)15(24)21-11-6-7-13(19)14(20)8-11/h6-8,12H,9-10H2,1-5H3,(H,21,24)(H,22,25) |
InChIKey | BDBJXDJHRQCGDD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(CC(CC(N1C)(C)C)NC(=O)C(=O)Nc2ccc(c(c2)F)Cl)C | ACDLabs 12.01 | Clc1ccc(cc1F)NC(=O)C(=O)NC2CC(N(C)C(C)(C)C2)(C)C | CACTVS 3.370 | CN1C(C)(C)CC(CC1(C)C)NC(=O)C(=O)Nc2ccc(Cl)c(F)c2 |
|
Formula | C18 H25 Cl F N3 O2 |
Name | N-(4-chloro-3-fluorophenyl)-N'-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanediamide |
ChEMBL | CHEMBL1645118 |
DrugBank | |
ZINC | ZINC000052913585
|
PDB chain | 4dko Chain C Residue 513
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|