Structure of PDB 6tp4 Chain A Binding Site BS01 |
|
|
Ligand ID | NRZ |
InChI | InChI=1S/C20H24N2O4S/c1-14-11-15(2)13-16(12-14)21-20(23)19-5-4-10-22(19)27(24,25)18-8-6-17(26-3)7-9-18/h6-9,11-13,19H,4-5,10H2,1-3H3,(H,21,23)/t19-/m0/s1 |
InChIKey | NHPQGZOBHSVTAQ-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1)[S](=O)(=O)N2CCC[C@H]2C(=O)Nc3cc(C)cc(C)c3 | CACTVS 3.385 | COc1ccc(cc1)[S](=O)(=O)N2CCC[CH]2C(=O)Nc3cc(C)cc(C)c3 | OpenEye OEToolkits 2.0.7 | Cc1cc(cc(c1)NC(=O)C2CCCN2S(=O)(=O)c3ccc(cc3)OC)C | OpenEye OEToolkits 2.0.7 | Cc1cc(cc(c1)NC(=O)[C@@H]2CCCN2S(=O)(=O)c3ccc(cc3)OC)C |
|
Formula | C20 H24 N2 O4 S |
Name | (2~{S})-~{N}-(3,5-dimethylphenyl)-1-(4-methoxyphenyl)sulfonyl-pyrrolidine-2-carboxamide |
ChEMBL | CHEMBL3597952 |
DrugBank | |
ZINC | ZINC000009068446
|
PDB chain | 6tp4 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|