Structure of PDB 4ylw Chain A Binding Site BS01 |
|
|
Ligand ID | 52Y |
InChI | InChI=1S/C20H15FN2O4S/c1-26-14-6-3-12(4-7-14)13-5-8-17(16(21)9-13)23-18(24)11-28-19(23)15(10-22)20(25)27-2/h3-9H,11H2,1-2H3/b19-15- |
InChIKey | VIKSKZVEJICSLD-CYVLTUHYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COc1ccc(cc1)c2ccc(c(c2)F)N3C(=O)CSC3=C(C#N)C(=O)OC | ACDLabs 12.01 | COc3ccc(c1ccc(c(c1)F)N2/C(SCC2=O)=C(/C(=O)OC)C#N)cc3 | CACTVS 3.385 | COC(=O)/C(C#N)=C/1SCC(=O)N/1c2ccc(cc2F)c3ccc(OC)cc3 | OpenEye OEToolkits 1.9.2 | COc1ccc(cc1)c2ccc(c(c2)F)N\3C(=O)CS/C3=C(/C#N)\C(=O)OC | CACTVS 3.385 | COC(=O)C(C#N)=C1SCC(=O)N1c2ccc(cc2F)c3ccc(OC)cc3 |
|
Formula | C20 H15 F N2 O4 S |
Name | methyl (2Z)-cyano[3-(3-fluoro-4'-methoxybiphenyl-4-yl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905167
|
PDB chain | 4ylw Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|