Structure of PDB 2vz6 Chain A Binding Site BS01 |
|
|
Ligand ID | FEF |
InChI | InChI=1S/C20H19N3O4/c24-11-12(25)9-10-27-23-18-14-6-2-4-8-16(14)21-19(18)17-13-5-1-3-7-15(13)22-20(17)26/h1-8,12,21,24-25H,9-11H2,(H,22,26)/b19-17-,23-18+/t12-/m1/s1 |
InChIKey | RKUMZEVCWKZXFV-YOCZKUTFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@H](O)CCO/N=C1/C(Nc2ccccc12)=C3/C(=O)Nc4ccccc34 | ACDLabs 10.04 | O=C2C(\c1ccccc1N2)=C4\C(=N\OCCC(O)CO)\c3ccccc3N4 | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)/C(=C/3\C(=N\OCC[C@H](CO)O)\c4ccccc4N3)/C(=O)N2 | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)C(=C3C(=NOCCC(CO)O)c4ccccc4N3)C(=O)N2 | CACTVS 3.341 | OC[CH](O)CCON=C1C(Nc2ccccc12)=C3C(=O)Nc4ccccc34 |
|
Formula | C20 H19 N3 O4 |
Name | (2Z,3E)-2,3'-BIINDOLE-2',3(1H,1'H)-DIONE 3-{O-[(3R)-3,4-DIHYDROXYBUTYL]OXIME} |
ChEMBL | |
DrugBank | DB07766 |
ZINC | ZINC000044681972
|
PDB chain | 2vz6 Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|