Structure of PDB 3mo0 Chain A Binding Site BS08 |
|
|
Ligand ID | E11 |
InChI | InChI=1S/C27H38N6O2/c1-32(2)14-8-13-28-27-30-23-18-25(35-4)24(34-3)17-22(23)26(31-27)29-21-11-15-33(16-12-21)19-20-9-6-5-7-10-20/h5-7,9-10,17-18,21H,8,11-16,19H2,1-4H3,(H2,28,29,30,31) |
InChIKey | YYFDMPHIONBOKZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CN(C)CCCNc1nc2cc(c(cc2c(n1)NC3CCN(CC3)Cc4ccccc4)OC)OC | ACDLabs 12.01 | O(c4cc1c(nc(nc1NC3CCN(Cc2ccccc2)CC3)NCCCN(C)C)cc4OC)C | CACTVS 3.370 | COc1cc2nc(NCCCN(C)C)nc(NC3CCN(CC3)Cc4ccccc4)c2cc1OC |
|
Formula | C27 H38 N6 O2 |
Name | N~4~-(1-benzylpiperidin-4-yl)-N~2~-[3-(dimethylamino)propyl]-6,7-dimethoxyquinazoline-2,4-diamine |
ChEMBL | CHEMBL1232432 |
DrugBank | |
ZINC | ZINC000058631426
|
PDB chain | 3mo0 Chain A Residue 2002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1124 Y1211 |
Catalytic site (residue number reindexed from 1) |
Y141 Y228 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|