Structure of PDB 7o0v Chain C Binding Site BS07 |
|
|
Ligand ID | V75 |
InChI | InChI=1S/C10H14O8/c1-4(11)17-6-3-16-9(10(14)15)7(13)8(6)18-5(2)12/h6-9,13H,3H2,1-2H3,(H,14,15)/t6-,7-,8+,9-/m0/s1 |
InChIKey | PUWANSDFPUWGOX-MAUMQABQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)O[C@H]1CO[C@@H]([C@@H](O)[C@@H]1OC(C)=O)C(O)=O | OpenEye OEToolkits 2.0.7 | CC(=O)OC1COC(C(C1OC(=O)C)O)C(=O)O | OpenEye OEToolkits 2.0.7 | CC(=O)O[C@H]1CO[C@@H]([C@H]([C@@H]1OC(=O)C)O)C(=O)O | CACTVS 3.385 | CC(=O)O[CH]1CO[CH]([CH](O)[CH]1OC(C)=O)C(O)=O |
|
Formula | C10 H14 O8 |
Name | (2~{S},3~{S},4~{S},5~{S})-4,5-diacetyloxy-3-oxidanyl-oxane-2-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7o0v Chain C Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|