Structure of PDB 2ow1 Chain A Binding Site BS07 |
|
|
Ligand ID | 7MR |
InChI | InChI=1S/C16H15F3N2O5S/c17-16(18,19)15(20,14(22)21-23)10-27(24,25)13-8-6-12(7-9-13)26-11-4-2-1-3-5-11/h1-9,23H,10,20H2,(H,21,22)/t15-/m1/s1 |
InChIKey | MKRPIBSCGZAUCH-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[C](C[S](=O)(=O)c1ccc(Oc2ccccc2)cc1)(C(=O)NO)C(F)(F)F | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)Oc2ccc(cc2)S(=O)(=O)CC(C(=O)NO)(C(F)(F)F)N | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)Oc2ccc(cc2)S(=O)(=O)C[C@@](C(=O)NO)(C(F)(F)F)N | ACDLabs 10.04 | FC(F)(F)C(C(=O)NO)(N)CS(=O)(=O)c2ccc(Oc1ccccc1)cc2 | CACTVS 3.341 | N[C@](C[S](=O)(=O)c1ccc(Oc2ccccc2)cc1)(C(=O)NO)C(F)(F)F |
|
Formula | C16 H15 F3 N2 O5 S |
Name | (2R)-2-AMINO-3,3,3-TRIFLUORO-N-HYDROXY-2-{[(4-PHENOXYPHENYL)SULFONYL]METHYL}PROPANAMIDE |
ChEMBL | |
DrugBank | DB07246 |
ZINC | ZINC000016052326
|
PDB chain | 2ow1 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|