Structure of PDB 3mo5 Chain C Binding Site BS06 |
|
|
Ligand ID | E72 |
InChI | InChI=1S/C29H52N8O2/c1-36(2)16-10-15-32-29-34-25-22-27(39-20-9-5-7-14-31)26(38-3)21-24(25)28(35-29)33-23-11-18-37(19-12-23)17-8-4-6-13-30/h21-23H,4-20,30-31H2,1-3H3,(H2,32,33,34,35) |
InChIKey | DCGOBPRQIYFVOD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CN(C)CCCNc1nc2cc(c(cc2c(n1)NC3CCN(CC3)CCCCCN)OC)OCCCCCN | CACTVS 3.370 | COc1cc2c(NC3CCN(CCCCCN)CC3)nc(NCCCN(C)C)nc2cc1OCCCCCN | ACDLabs 12.01 | O(c3cc1c(nc(nc1NC2CCN(CCCCCN)CC2)NCCCN(C)C)cc3OCCCCCN)C |
|
Formula | C29 H52 N8 O2 |
Name | 7-[(5-aminopentyl)oxy]-N~4~-[1-(5-aminopentyl)piperidin-4-yl]-N~2~-[3-(dimethylamino)propyl]-6-methoxyquinazoline-2,4-diamine |
ChEMBL | CHEMBL1232453 |
DrugBank | |
ZINC |
|
PDB chain | 3mo5 Chain C Residue 1236
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1124 Y1211 |
Catalytic site (residue number reindexed from 1) |
Y150 Y234 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|