Structure of PDB 6go2 Chain A Binding Site BS06 |
|
|
Ligand ID | LU0 |
InChI | InChI=1S/C6H14N2O4S/c1-4(2)3-5(6(9)10)8-13(7,11)12/h4-5,8H,3H2,1-2H3,(H,9,10)(H2,7,11,12)/t5-/m0/s1 |
InChIKey | WYJHWWUFTZEBIK-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)C[CH](N[S](N)(=O)=O)C(O)=O | OpenEye OEToolkits 2.0.6 | CC(C)C[C@@H](C(=O)O)NS(=O)(=O)N | OpenEye OEToolkits 2.0.6 | CC(C)CC(C(=O)O)NS(=O)(=O)N | CACTVS 3.385 | CC(C)C[C@H](N[S](N)(=O)=O)C(O)=O |
|
Formula | C6 H14 N2 O4 S |
Name | Sulphamoil Leucine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6go2 Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|