Structure of PDB 6f6q Chain A Binding Site BS06 |
|
|
Ligand ID | 0X9 |
InChI | InChI=1S/C6H15N5O4S/c7-6(8)10-3-1-2-4(5(12)13)11-16(9,14)15/h4,11H,1-3H2,(H,12,13)(H4,7,8,10)(H2,9,14,15)/t4-/m0/s1 |
InChIKey | PBEOTCYEZLQJNW-BYPYZUCNSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(NC(C(=O)O)CCCNC(=[N@H])N)N | OpenEye OEToolkits 1.7.6 | C(CC(C(=O)O)NS(=O)(=O)N)CNC(=N)N | CACTVS 3.370 | NC(=N)NCCC[CH](N[S](N)(=O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | [H]/N=C(\N)/NCCC[C@@H](C(=O)O)NS(=O)(=O)N | CACTVS 3.370 | NC(=N)NCCC[C@H](N[S](N)(=O)=O)C(O)=O |
|
Formula | C6 H15 N5 O4 S |
Name | N~2~-sulfamoyl-L-arginine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920512
|
PDB chain | 6f6q Chain A Residue 408
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|