Structure of PDB 6ekn Chain A Binding Site BS06 |
|
|
Ligand ID | B9N |
InChI | InChI=1S/C24H22O7S/c1-31-18-10-6-16(7-11-18)17-8-12-19(13-9-17)32(29,30)22-5-3-2-4-20(22)21(24(27)28)14-15-23(25)26/h2-13,21H,14-15H2,1H3,(H,25,26)(H,27,28)/t21-/m0/s1 |
InChIKey | QMSIXYWYTRVTIW-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1ccc(cc1)c2ccc(cc2)S(=O)(=O)c3ccccc3C(CCC(=O)O)C(=O)O | CACTVS 3.385 | COc1ccc(cc1)c2ccc(cc2)[S](=O)(=O)c3ccccc3[CH](CCC(O)=O)C(O)=O | OpenEye OEToolkits 2.0.6 | COc1ccc(cc1)c2ccc(cc2)S(=O)(=O)c3ccccc3[C@H](CCC(=O)O)C(=O)O | CACTVS 3.385 | COc1ccc(cc1)c2ccc(cc2)[S](=O)(=O)c3ccccc3[C@H](CCC(O)=O)C(O)=O |
|
Formula | C24 H22 O7 S |
Name | (2~{S})-2-[2-[4-(4-methoxyphenyl)phenyl]sulfonylphenyl]pentanedioic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ekn Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|