Structure of PDB 5ccl Chain A Binding Site BS06 |
|
|
Ligand ID | 4ZW |
InChI | InChI=1S/C14H17N3O2/c18-13-8-10-7-9(1-2-12(10)17-13)14(19)16-11-3-5-15-6-4-11/h1-2,7,11,15H,3-6,8H2,(H,16,19)(H,17,18) |
InChIKey | SWMKOYKJOHHEQD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc2c(cc1C(=O)NC3CCNCC3)CC(=O)N2 | CACTVS 3.385 | O=C1Cc2cc(ccc2N1)C(=O)NC3CCNCC3 |
|
Formula | C14 H17 N3 O2 |
Name | 2-oxidanylidene-N-piperidin-4-yl-1,3-dihydroindole-5-carboxamide |
ChEMBL | CHEMBL3798717 |
DrugBank | |
ZINC | ZINC000076319921
|
PDB chain | 5ccl Chain A Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.354: [histone H3]-lysine(4) N-trimethyltransferase. |
|
|
|