Structure of PDB 5b5p Chain A Binding Site BS06 |
|
|
Ligand ID | WNN |
InChI | InChI=1S/C20H18N6O3S/c27-18-15-6-1-2-7-16(15)24-17(25-18)19(28)21-11-13-4-3-5-14(10-13)29-8-9-30-20-22-12-23-26-20/h1-7,10,12H,8-9,11H2,(H,21,28)(H,22,23,26)(H,24,25,27) |
InChIKey | OXTBPBSHWBJLJN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C(NCc1cccc(OCCSc2n[nH]cn2)c1)C3=Nc4ccccc4C(=O)N3 | ACDLabs 12.01 | O=C1c4ccccc4N=C(N1)C(=O)NCc3cc(OCCSc2ncnn2)ccc3 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(=O)NC(=N2)C(=O)NCc3cccc(c3)OCCSc4nc[nH]n4 |
|
Formula | C20 H18 N6 O3 S |
Name | 4-oxo-N-{3-[2-(1H-1,2,4-triazol-3-ylsulfanyl)ethoxy]benzyl}-3,4-dihydroquinazoline-2-carboxamide |
ChEMBL | CHEMBL4083954 |
DrugBank | |
ZINC | ZINC000114402846
|
PDB chain | 5b5p Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|