Structure of PDB 4efs Chain A Binding Site BS06 |
|
|
Ligand ID | E37 |
InChI | InChI=1S/C22H20N2O4S/c23-21(27)18(10-11-20(25)26)24-22(28)16-8-6-15(7-9-16)19-12-17(13-29-19)14-4-2-1-3-5-14/h1-9,12-13,18H,10-11H2,(H2,23,27)(H,24,28)(H,25,26)/t18-/m0/s1 |
InChIKey | ADDJDJQFPKUMAF-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC(=O)[C@H](CCC(O)=O)NC(=O)c1ccc(cc1)c2scc(c2)c3ccccc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2cc(sc2)c3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)N | ACDLabs 12.01 | O=C(O)CCC(C(=O)N)NC(=O)c3ccc(c2scc(c1ccccc1)c2)cc3 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2cc(sc2)c3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)N | CACTVS 3.370 | NC(=O)[CH](CCC(O)=O)NC(=O)c1ccc(cc1)c2scc(c2)c3ccccc3 |
|
Formula | C22 H20 N2 O4 S |
Name | N~2~-[4-(4-phenylthiophen-2-yl)benzoyl]-L-alpha-glutamine |
ChEMBL | CHEMBL4761188 |
DrugBank | |
ZINC | ZINC000089469596
|
PDB chain | 4efs Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|