Structure of PDB 3tvc Chain A Binding Site BS06 |
|
|
Ligand ID | E3P |
InChI | InChI=1S/C26H26N2O4/c27-26(32)23(15-17-25(30)31)28-24(29)16-8-18-6-9-20(10-7-18)22-13-11-21(12-14-22)19-4-2-1-3-5-19/h1-7,9-14,23H,8,15-17H2,(H2,27,32)(H,28,29)(H,30,31)/t23-/m0/s1 |
InChIKey | KNOYHJOPRUTPSQ-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CCC(C(=O)N)NC(=O)CCc1ccc(cc1)c3ccc(c2ccccc2)cc3 | OpenEye OEToolkits 1.7.2 | c1ccc(cc1)c2ccc(cc2)c3ccc(cc3)CCC(=O)NC(CCC(=O)O)C(=O)N | CACTVS 3.370 | NC(=O)[C@H](CCC(O)=O)NC(=O)CCc1ccc(cc1)c2ccc(cc2)c3ccccc3 | OpenEye OEToolkits 1.7.2 | c1ccc(cc1)c2ccc(cc2)c3ccc(cc3)CCC(=O)N[C@@H](CCC(=O)O)C(=O)N | CACTVS 3.370 | NC(=O)[CH](CCC(O)=O)NC(=O)CCc1ccc(cc1)c2ccc(cc2)c3ccccc3 |
|
Formula | C26 H26 N2 O4 |
Name | N~2~-[3-(1,1':4',1''-terphenyl-4-yl)propanoyl]-L-alpha-glutamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000089469598
|
PDB chain | 3tvc Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|