Structure of PDB 3k5k Chain A Binding Site BS06 |
|
|
Ligand ID | DXQ |
InChI | InChI=1S/C26H43N7O2/c1-30(2)10-7-17-35-24-19-22-21(18-23(24)34-5)25(27-20-8-13-32(4)14-9-20)29-26(28-22)33-12-6-11-31(3)15-16-33/h18-20H,6-17H2,1-5H3,(H,27,28,29) |
InChIKey | XIVUGRBSBIXXJE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C[N@]1CCCN(CC1)c2nc3cc(c(cc3c(n2)NC4CCN(CC4)C)OC)OCCCN(C)C | CACTVS 3.352 | COc1cc2c(NC3CCN(C)CC3)nc(nc2cc1OCCCN(C)C)N4CCCN(C)CC4 | OpenEye OEToolkits 1.7.0 | CN1CCCN(CC1)c2nc3cc(c(cc3c(n2)NC4CCN(CC4)C)OC)OCCCN(C)C | ACDLabs 11.02 | O(c3cc2nc(nc(NC1CCN(C)CC1)c2cc3OC)N4CCCN(C)CC4)CCCN(C)C |
|
Formula | C26 H43 N7 O2 |
Name | 7-[3-(dimethylamino)propoxy]-6-methoxy-2-(4-methyl-1,4-diazepan-1-yl)-N-(1-methylpiperidin-4-yl)quinazolin-4-amine |
ChEMBL | CHEMBL576781 |
DrugBank | |
ZINC | ZINC000036382580
|
PDB chain | 3k5k Chain A Residue 2000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1067 Y1154 |
Catalytic site (residue number reindexed from 1) |
Y151 Y236 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|