Structure of PDB 3i7g Chain A Binding Site BS06 |
|
|
Ligand ID | 732 |
InChI | InChI=1S/C20H23ClN2O3/c1-22-20(25)18(14-5-3-2-4-6-14)23-19(24)17-12-11-16(26-17)13-7-9-15(21)10-8-13/h7-12,14,18H,2-6H2,1H3,(H,22,25)(H,23,24)/t18-/m0/s1 |
InChIKey | SOSADZXKACRLDA-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CNC(=O)[CH](NC(=O)c1oc(cc1)c2ccc(Cl)cc2)C3CCCCC3 | CACTVS 3.352 | CNC(=O)[C@@H](NC(=O)c1oc(cc1)c2ccc(Cl)cc2)C3CCCCC3 | OpenEye OEToolkits 1.7.0 | CNC(=O)C(C1CCCCC1)NC(=O)c2ccc(o2)c3ccc(cc3)Cl | ACDLabs 11.02 | O=C(c2oc(c1ccc(Cl)cc1)cc2)NC(C(=O)NC)C3CCCCC3 | OpenEye OEToolkits 1.7.0 | CNC(=O)[C@H](C1CCCCC1)NC(=O)c2ccc(o2)c3ccc(cc3)Cl |
|
Formula | C20 H23 Cl N2 O3 |
Name | 5-(4-chlorophenyl)-N-[(1S)-1-cyclohexyl-2-(methylamino)-2-oxoethyl]furan-2-carboxamide |
ChEMBL | CHEMBL577910 |
DrugBank | |
ZINC | ZINC000044667949
|
PDB chain | 3i7g Chain A Residue 999
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|