Structure of PDB 3ehx Chain A Binding Site BS06 |
|
|
Ligand ID | BDL |
InChI | InChI=1S/C18H21NO4S/c1-13(2)12-17(18(20)21)19-24(22,23)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,13,17,19H,12H2,1-2H3,(H,20,21)/t17-/m1/s1 |
InChIKey | FBSVJQQVDISETN-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)C[CH](N[S](=O)(=O)c1ccc(cc1)c2ccccc2)C(O)=O | OpenEye OEToolkits 1.5.0 | CC(C)C[C@H](C(=O)O)NS(=O)(=O)c1ccc(cc1)c2ccccc2 | ACDLabs 10.04 | O=C(O)C(NS(=O)(=O)c2ccc(c1ccccc1)cc2)CC(C)C | OpenEye OEToolkits 1.5.0 | CC(C)CC(C(=O)O)NS(=O)(=O)c1ccc(cc1)c2ccccc2 | CACTVS 3.341 | CC(C)C[C@@H](N[S](=O)(=O)c1ccc(cc1)c2ccccc2)C(O)=O |
|
Formula | C18 H21 N O4 S |
Name | N-(biphenyl-4-ylsulfonyl)-D-leucine; (R)-2-(biphenyl-4-ylsulfonamido)-4-methylpentanoic acid |
ChEMBL | |
DrugBank | DB07446 |
ZINC |
|
PDB chain | 3ehx Chain A Residue 0
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|