Structure of PDB 1g5n Chain A Binding Site BS06 |
|
|
Ligand ID | UAP |
InChI | InChI=1S/C6H8O9S/c7-2-1-3(5(8)9)14-6(10)4(2)15-16(11,12)13/h1-2,4,6-7,10H,(H,8,9)(H,11,12,13)/t2-,4+,6+/m0/s1 |
InChIKey | VJIMUKBSNUBECH-YKKSOZKNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1=C(OC(C(C1O)OS(=O)(=O)O)O)C(=O)O | CACTVS 3.370 | O[CH]1OC(=C[CH](O)[CH]1O[S](O)(=O)=O)C(O)=O | CACTVS 3.370 | O[C@@H]1OC(=C[C@H](O)[C@H]1O[S](O)(=O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C=1OC(O)C(OS(=O)(=O)O)C(O)C=1 | OpenEye OEToolkits 1.7.6 | C1=C(O[C@H]([C@@H]([C@H]1O)OS(=O)(=O)O)O)C(=O)O |
|
Formula | C6 H8 O9 S |
Name | 4-deoxy-2-O-sulfo-alpha-L-threo-hex-4-enopyranuronic acid; 4-deoxy-2-O-sulfo-alpha-L-threo-hex-4-enuronic acid; 4-deoxy-2-O-sulfo-L-threo-hex-4-enuronic acid; 4-deoxy-2-O-sulfo-threo-hex-4-enuronic acid |
ChEMBL | |
DrugBank | DB03981 |
ZINC | ZINC000005834516
|
PDB chain | 1g5n Chain C Residue 4
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|