Structure of PDB 7prc Chain L Binding Site BS05 |
|
|
Ligand ID | CET |
InChI | InChI=1S/C10H15ClN6/c1-4-10(3,6-12)17-9-15-7(11)14-8(16-9)13-5-2/h4-5H2,1-3H3,(H2,13,14,15,16,17)/t10-/m1/s1 |
InChIKey | IUCVBFHDSFSEIK-SNVBAGLBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CCNc1nc(Cl)nc(N[C](C)(CC)C#N)n1 | ACDLabs 10.04 | Clc1nc(nc(n1)NC(C#N)(C)CC)NCC | OpenEye OEToolkits 1.5.0 | CC[C@](C)(C#N)Nc1nc(nc(n1)Cl)NCC | CACTVS 3.341 | CCNc1nc(Cl)nc(N[C@](C)(CC)C#N)n1 | OpenEye OEToolkits 1.5.0 | CCC(C)(C#N)Nc1nc(nc(n1)Cl)NCC |
|
Formula | C10 H15 Cl N6 |
Name | 2-CHLORO-4-ETHYLAMINO-6-(R(+)-2'-CYANO-4-BUTYLAMINO)-1,3,5-TRIAZINE; DG-420315 |
ChEMBL | |
DrugBank | DB07552 |
ZINC | ZINC000002047027
|
PDB chain | 7prc Chain L Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|